C24H34N4O — CID 95868809
2-[(2R)-1-[[3-(4-cyclohexylphenyl)-1-methylpyrazol-4-yl]methyl]piperidin-2-yl]acetamide (PubChem CID 95868809) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-[(2R)-1-[[3-(4-cyclohexylphenyl)-1-methylpyrazol-4-yl]methyl]piperidin-2-yl]acetamide.
| Compound Name | 2-[(2R)-1-[[3-(4-cyclohexylphenyl)-1-methylpyrazol-4-yl]methyl]piperidin-2-yl]acetamide |
|---|---|
| PubChem CID | 95868809 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2-[(2R)-1-[[3-(4-cyclohexylphenyl)-1-methylpyrazol-4-yl]methyl]piperidin-2-yl]acetamide |
| SMILES | Cn1cc(CN2CCCC[C@@H]2CC(N)=O)c(-c2ccc(C3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C24H34N4O/c1-27-16-21(17-28-14-6-5-9-22(28)15-23(25)29)24(26-27)20-12-10-19(11-13-20)18-7-3-2-4-8-18/h10-13,16,18,22H,2-9,14-15,17H2,1H3,(H2,25,29)/t22-/m1/s1 |
| InChIKey | KKCWQALGPKGGOW-JOCHJYFZSA-N |
| XLogP | 4.36 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |