C18H15ClN4O3S2 — CID 42353144
N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 42353144) has the molecular formula C18H15ClN4O3S2 and a molecular weight of 434.93 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 42353144 |
| Molecular Formula | C18H15ClN4O3S2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | O=C(Nc1ncc(Cc2cccc(Cl)c2)s1)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C18H15ClN4O3S2/c19-14-3-1-2-12(8-14)9-15-10-20-18(27-15)21-17(24)13-4-5-16-22-28(25,26)7-6-23(16)11-13/h1-5,8,10-11H,6-7,9H2,(H,20,21,24) |
| InChIKey | ZOOXVNKUKSBCRH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |