C19H23FN2O2 — CID 42371584
1-[(1R)-cyclohex-3-ene-1-carbonyl]-4-[(3-fluorophenyl)methyl]-1,4-diazepan-5-one (PubChem CID 42371584) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-[(1R)-cyclohex-3-ene-1-carbonyl]-4-[(3-fluorophenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | 1-[(1R)-cyclohex-3-ene-1-carbonyl]-4-[(3-fluorophenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 42371584 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[(1R)-cyclohex-3-ene-1-carbonyl]-4-[(3-fluorophenyl)methyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)[C@H]2CC=CCC2)CCN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H23FN2O2/c20-17-8-4-5-15(13-17)14-22-12-11-21(10-9-18(22)23)19(24)16-6-2-1-3-7-16/h1-2,4-5,8,13,16H,3,6-7,9-12,14H2/t16-/m0/s1 |
| InChIKey | SJDHDZRBLQOIJY-INIZCTEOSA-N |
| XLogP | 2.74 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|