C18H16N4O6S — CID 42378381
N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide (PubChem CID 42378381) has the molecular formula C18H16N4O6S and a molecular weight of 416.42 g/mol. Its IUPAC name is N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 42378381 |
| Molecular Formula | C18H16N4O6S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)COc3ccccc3[N+](=O)[O-])n2)o1 |
| InChI | InChI=1S/C18H16N4O6S/c1-11(23)19-8-12-6-7-15(28-12)13-10-29-18(20-13)21-17(24)9-27-16-5-3-2-4-14(16)22(25)26/h2-7,10H,8-9H2,1H3,(H,19,23)(H,20,21,24) |
| InChIKey | LYIBSJXWVHNJFZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|