C23H27FN2O2S — CID 42380029
(E)-3-(3-fluorophenyl)-N-[(2S)-2-[3-(thiomorpholin-4-ylmethyl)phenoxy]propyl]prop-2-enamide (PubChem CID 42380029) has the molecular formula C23H27FN2O2S and a molecular weight of 414.55 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-[(2S)-2-[3-(thiomorpholin-4-ylmethyl)phenoxy]propyl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-[(2S)-2-[3-(thiomorpholin-4-ylmethyl)phenoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 42380029 |
| Molecular Formula | C23H27FN2O2S |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-[(2S)-2-[3-(thiomorpholin-4-ylmethyl)phenoxy]propyl]prop-2-enamide |
| SMILES | C[C@@H](CNC(=O)/C=C/c1cccc(F)c1)Oc1cccc(CN2CCSCC2)c1 |
| InChI | InChI=1S/C23H27FN2O2S/c1-18(16-25-23(27)9-8-19-4-2-6-21(24)14-19)28-22-7-3-5-20(15-22)17-26-10-12-29-13-11-26/h2-9,14-15,18H,10-13,16-17H2,1H3,(H,25,27)/b9-8+/t18-/m0/s1 |
| InChIKey | XNOXUVFOBVXYBB-BLGFXRMMSA-N |
| XLogP | 3.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|