C17H26N2O3S — CID 42541715
2-methoxy-N-[(2R)-2-[3-(thiomorpholin-4-ylmethyl)phenoxy]propyl]acetamide (PubChem CID 42541715) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 2-methoxy-N-[(2R)-2-[3-(thiomorpholin-4-ylmethyl)phenoxy]propyl]acetamide.
| Compound Name | 2-methoxy-N-[(2R)-2-[3-(thiomorpholin-4-ylmethyl)phenoxy]propyl]acetamide |
|---|---|
| PubChem CID | 42541715 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-methoxy-N-[(2R)-2-[3-(thiomorpholin-4-ylmethyl)phenoxy]propyl]acetamide |
| SMILES | COCC(=O)NC[C@@H](C)Oc1cccc(CN2CCSCC2)c1 |
| InChI | InChI=1S/C17H26N2O3S/c1-14(11-18-17(20)13-21-2)22-16-5-3-4-15(10-16)12-19-6-8-23-9-7-19/h3-5,10,14H,6-9,11-13H2,1-2H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | XLWVKFWSWLTQQW-CQSZACIVSA-N |
| XLogP | 1.77 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |