C22H31N5O3 — CID 42382756
1-[4-[3-(2-methoxyphenyl)propanoylamino]cyclohexyl]-N-propan-2-yltriazole-4-carboxamide (PubChem CID 42382756) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[4-[3-(2-methoxyphenyl)propanoylamino]cyclohexyl]-N-propan-2-yltriazole-4-carboxamide.
| Compound Name | 1-[4-[3-(2-methoxyphenyl)propanoylamino]cyclohexyl]-N-propan-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 42382756 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-[4-[3-(2-methoxyphenyl)propanoylamino]cyclohexyl]-N-propan-2-yltriazole-4-carboxamide |
| SMILES | COc1ccccc1CCC(=O)NC1CCC(n2cc(C(=O)NC(C)C)nn2)CC1 |
| InChI | InChI=1S/C22H31N5O3/c1-15(2)23-22(29)19-14-27(26-25-19)18-11-9-17(10-12-18)24-21(28)13-8-16-6-4-5-7-20(16)30-3/h4-7,14-15,17-18H,8-13H2,1-3H3,(H,23,29)(H,24,28) |
| InChIKey | UWFOESPYXOCFHK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |