C21H17N3O4S2 — CID 42387325
(5R)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 42387325) has the molecular formula C21H17N3O4S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is (5R)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 42387325 |
| Molecular Formula | C21H17N3O4S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (5R)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | Cc1nnc(N2C(=O)C(=O)C(=C(O)c3ccc4c(c3)C[C@@H](C)O4)[C@@H]2c2cccs2)s1 |
| InChI | InChI=1S/C21H17N3O4S2/c1-10-8-13-9-12(5-6-14(13)28-10)18(25)16-17(15-4-3-7-29-15)24(20(27)19(16)26)21-23-22-11(2)30-21/h3-7,9-10,17,25H,8H2,1-2H3/t10-,17+/m1/s1 |
| InChIKey | RKVJEQHEWMVIEG-QGHHPUGFSA-N |
| XLogP | 3.86 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|