C18H19NO4S2 — CID 42387357
4-[(5Z)-5-[[(2R)-2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 42387357) has the molecular formula C18H19NO4S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[(5Z)-5-[[(2R)-2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5Z)-5-[[(2R)-2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 42387357 |
| Molecular Formula | C18H19NO4S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-[(5Z)-5-[[(2R)-2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | Cc1cc(/C=C2\SC(=S)N(CCCC(=O)O)C2=O)cc2c1O[C@H](C)C2 |
| InChI | InChI=1S/C18H19NO4S2/c1-10-6-12(8-13-7-11(2)23-16(10)13)9-14-17(22)19(18(24)25-14)5-3-4-15(20)21/h6,8-9,11H,3-5,7H2,1-2H3,(H,20,21)/b14-9-/t11-/m1/s1 |
| InChIKey | HLUARHNHXQOLRG-RLIURORJSA-N |
| XLogP | 3.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|