C17H17NO5S — CID 126609420
3-[(5Z)-5-[(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 126609420) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 3-[(5Z)-5-[(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 126609420 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 3-[(5Z)-5-[(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | Cc1cc(/C=C2\SC(=O)N(CCC(=O)O)C2=O)cc2c1OC(C)C2 |
| InChI | InChI=1S/C17H17NO5S/c1-9-5-11(7-12-6-10(2)23-15(9)12)8-13-16(21)18(17(22)24-13)4-3-14(19)20/h5,7-8,10H,3-4,6H2,1-2H3,(H,19,20)/b13-8- |
| InChIKey | QWYYJOPFTCTFDO-JYRVWZFOSA-N |
| XLogP | 2.83 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|