C20H25F2N3O2S — CID 42389081
1-(4-fluorophenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]methanesulfonamide (PubChem CID 42389081) has the molecular formula C20H25F2N3O2S and a molecular weight of 409.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 42389081 |
| Molecular Formula | C20H25F2N3O2S |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)NCCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H25F2N3O2S/c21-18-8-6-17(7-9-18)16-28(26,27)23-10-3-11-24-12-14-25(15-13-24)20-5-2-1-4-19(20)22/h1-2,4-9,23H,3,10-16H2 |
| InChIKey | OOGKLKPZAFBFLX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|