C22H19FN6O4 — CID 42391455
N-[2-[5-[(4-fluorophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]-4-methyl-3-nitrobenzamide (PubChem CID 42391455) has the molecular formula C22H19FN6O4 and a molecular weight of 450.43 g/mol. Its IUPAC name is N-[2-[5-[(4-fluorophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[5-[(4-fluorophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 42391455 |
| Molecular Formula | C22H19FN6O4 |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[2-[5-[(4-fluorophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NCCn2ncc3c(=O)n(Cc4ccc(F)cc4)cnc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19FN6O4/c1-14-2-5-16(10-19(14)29(32)33)21(30)24-8-9-28-20-18(11-26-28)22(31)27(13-25-20)12-15-3-6-17(23)7-4-15/h2-7,10-11,13H,8-9,12H2,1H3,(H,24,30) |
| InChIKey | LFRJNFDEVDEBBK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|