C21H17N7O6 — CID 42391597
4-nitro-N-[2-[5-[(3-nitrophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]benzamide (PubChem CID 42391597) has the molecular formula C21H17N7O6 and a molecular weight of 463.41 g/mol. Its IUPAC name is 4-nitro-N-[2-[5-[(3-nitrophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]benzamide.
| Compound Name | 4-nitro-N-[2-[5-[(3-nitrophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 42391597 |
| Molecular Formula | C21H17N7O6 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 4-nitro-N-[2-[5-[(3-nitrophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCCn1ncc2c(=O)n(Cc3cccc([N+](=O)[O-])c3)cnc21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17N7O6/c29-20(15-4-6-16(7-5-15)27(31)32)22-8-9-26-19-18(11-24-26)21(30)25(13-23-19)12-14-2-1-3-17(10-14)28(33)34/h1-7,10-11,13H,8-9,12H2,(H,22,29) |
| InChIKey | YQSCJLCUPIISSS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 168.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|