C21H16Cl2N6O4 — CID 42391722
2,4-dichloro-N-[2-[5-[(4-nitrophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]benzamide (PubChem CID 42391722) has the molecular formula C21H16Cl2N6O4 and a molecular weight of 487.30 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[5-[(4-nitrophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[5-[(4-nitrophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 42391722 |
| Molecular Formula | C21H16Cl2N6O4 |
| Molecular Weight | 487.30 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 2,4-dichloro-N-[2-[5-[(4-nitrophenyl)methyl]-4-oxopyrazolo[5,4-d]pyrimidin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCCn1ncc2c(=O)n(Cc3ccc([N+](=O)[O-])cc3)cnc21)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl2N6O4/c22-14-3-6-16(18(23)9-14)20(30)24-7-8-28-19-17(10-26-28)21(31)27(12-25-19)11-13-1-4-15(5-2-13)29(32)33/h1-6,9-10,12H,7-8,11H2,(H,24,30) |
| InChIKey | ADLLYXPLXXESAZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|