C20H29FN2O — CID 42393054
N-ethyl-N-[[(3R)-1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]cyclopropanecarboxamide (PubChem CID 42393054) has the molecular formula C20H29FN2O and a molecular weight of 332.46 g/mol. Its IUPAC name is N-ethyl-N-[[(3R)-1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]cyclopropanecarboxamide.
| Compound Name | N-ethyl-N-[[(3R)-1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 42393054 |
| Molecular Formula | C20H29FN2O |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | N-ethyl-N-[[(3R)-1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]cyclopropanecarboxamide |
| SMILES | CCN(C[C@@H]1CCCN(CCc2cccc(F)c2)C1)C(=O)C1CC1 |
| InChI | InChI=1S/C20H29FN2O/c1-2-23(20(24)18-8-9-18)15-17-6-4-11-22(14-17)12-10-16-5-3-7-19(21)13-16/h3,5,7,13,17-18H,2,4,6,8-12,14-15H2,1H3/t17-/m1/s1 |
| InChIKey | KCPHCYHSHDDPQX-QGZVFWFLSA-N |
| XLogP | 3.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |