C22H33FN2O2 — CID 42557076
N-ethyl-N-[[(3R)-1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]-4-methyl-2-oxopentanamide (PubChem CID 42557076) has the molecular formula C22H33FN2O2 and a molecular weight of 376.52 g/mol. Its IUPAC name is N-ethyl-N-[[(3R)-1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]-4-methyl-2-oxopentanamide.
| Compound Name | N-ethyl-N-[[(3R)-1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]-4-methyl-2-oxopentanamide |
|---|---|
| PubChem CID | 42557076 |
| Molecular Formula | C22H33FN2O2 |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | N-ethyl-N-[[(3R)-1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]-4-methyl-2-oxopentanamide |
| SMILES | CCN(C[C@@H]1CCCN(CCc2cccc(F)c2)C1)C(=O)C(=O)CC(C)C |
| InChI | InChI=1S/C22H33FN2O2/c1-4-25(22(27)21(26)13-17(2)3)16-19-8-6-11-24(15-19)12-10-18-7-5-9-20(23)14-18/h5,7,9,14,17,19H,4,6,8,10-13,15-16H2,1-3H3/t19-/m1/s1 |
| InChIKey | QRSFQXHUJGXTAM-LJQANCHMSA-N |
| XLogP | 3.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|