C17H20F2N3O3+ — CID 42396124
3-[2-[(3R)-3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]-2H-oxadiazol-3-ium-5-one (PubChem CID 42396124) has the molecular formula C17H20F2N3O3+ and a molecular weight of 352.36 g/mol. Its IUPAC name is 3-[2-[(3R)-3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]-2H-oxadiazol-3-ium-5-one.
| Compound Name | 3-[2-[(3R)-3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 42396124 |
| Molecular Formula | C17H20F2N3O3+ |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-[2-[(3R)-3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]-2H-oxadiazol-3-ium-5-one |
| SMILES | O=C(C[n+]1cc(=O)o[nH]1)N1CCC[C@@H](CCc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C17H19F2N3O3/c18-14-6-5-12(8-15(14)19)3-4-13-2-1-7-21(9-13)16(23)10-22-11-17(24)25-20-22/h5-6,8,11,13H,1-4,7,9-10H2/p+1/t13-/m0/s1 |
| InChIKey | DRGMNTSCRNPVKF-ZDUSSCGKSA-O |
| XLogP | 1.40 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|