C30H32Cl2N4O4S — CID 4240222
N-(3,4-dichlorophenyl)-2-[[4-(2-phenylethyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4240222) has the molecular formula C30H32Cl2N4O4S and a molecular weight of 615.58 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[[4-(2-phenylethyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[[4-(2-phenylethyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4240222 |
| Molecular Formula | C30H32Cl2N4O4S |
| Molecular Weight | 615.58 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[[4-(2-phenylethyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1cc(-c2nnc(SCC(=O)Nc3ccc(Cl)c(Cl)c3)n2CCc2ccccc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C30H32Cl2N4O4S/c1-4-38-25-16-21(17-26(39-5-2)28(25)40-6-3)29-34-35-30(36(29)15-14-20-10-8-7-9-11-20)41-19-27(37)33-22-12-13-23(31)24(32)18-22/h7-13,16-18H,4-6,14-15,19H2,1-3H3,(H,33,37) |
| InChIKey | FHOLNZFTPGTQSH-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.58 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |