C33H38N4O4S — CID 17078354
N-(2,3-dihydro-1H-inden-2-yl)-2-[[4-(2-phenylethyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17078354) has the molecular formula C33H38N4O4S and a molecular weight of 586.76 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-2-[[4-(2-phenylethyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-2-[[4-(2-phenylethyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17078354 |
| Molecular Formula | C33H38N4O4S |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-2-[[4-(2-phenylethyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1cc(-c2nnc(SCC(=O)NC3Cc4ccccc4C3)n2CCc2ccccc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C33H38N4O4S/c1-4-39-28-20-26(21-29(40-5-2)31(28)41-6-3)32-35-36-33(37(32)17-16-23-12-8-7-9-13-23)42-22-30(38)34-27-18-24-14-10-11-15-25(24)19-27/h7-15,20-21,27H,4-6,16-19,22H2,1-3H3,(H,34,38) |
| InChIKey | GTRRAYLEBSNSPI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |