C25H30N4O3S — CID 17078348
N-(2,3-dihydro-1H-inden-2-yl)-2-[[4-(3-ethoxypropyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17078348) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-2-[[4-(3-ethoxypropyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-2-[[4-(3-ethoxypropyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17078348 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-2-[[4-(3-ethoxypropyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCOCCCn1c(SCC(=O)NC2Cc3ccccc3C2)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H30N4O3S/c1-3-32-14-6-13-29-24(18-9-11-22(31-2)12-10-18)27-28-25(29)33-17-23(30)26-21-15-19-7-4-5-8-20(19)16-21/h4-5,7-12,21H,3,6,13-17H2,1-2H3,(H,26,30) |
| InChIKey | YPAZLAQZQLLGBR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|