C20H24N2O5 — CID 42403444
5-[(4-acetyl-2-methoxyphenoxy)methyl]-N-ethyl-N-(2-methylprop-2-enyl)-1,2-oxazole-3-carboxamide (PubChem CID 42403444) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 5-[(4-acetyl-2-methoxyphenoxy)methyl]-N-ethyl-N-(2-methylprop-2-enyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[(4-acetyl-2-methoxyphenoxy)methyl]-N-ethyl-N-(2-methylprop-2-enyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 42403444 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 5-[(4-acetyl-2-methoxyphenoxy)methyl]-N-ethyl-N-(2-methylprop-2-enyl)-1,2-oxazole-3-carboxamide |
| SMILES | C=C(C)CN(CC)C(=O)c1cc(COc2ccc(C(C)=O)cc2OC)on1 |
| InChI | InChI=1S/C20H24N2O5/c1-6-22(11-13(2)3)20(24)17-10-16(27-21-17)12-26-18-8-7-15(14(4)23)9-19(18)25-5/h7-10H,2,6,11-12H2,1,3-5H3 |
| InChIKey | KMSIUKVNXQGUFY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|