C19H17N3O2S — CID 42411442
(3R)-3-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxolan-2-one (PubChem CID 42411442) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is (3R)-3-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxolan-2-one.
| Compound Name | (3R)-3-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxolan-2-one |
|---|---|
| PubChem CID | 42411442 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | (3R)-3-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxolan-2-one |
| SMILES | O=C1OCC[C@H]1Sc1nnc(Cc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C19H17N3O2S/c23-18-16(11-12-24-18)25-19-21-20-17(13-14-7-3-1-4-8-14)22(19)15-9-5-2-6-10-15/h1-10,16H,11-13H2/t16-/m1/s1 |
| InChIKey | FSBKXDQMOZYIFO-MRXNPFEDSA-N |
| XLogP | 3.27 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |