C23H29NO4 — CID 42417638
7-(3,4-dimethoxyphenyl)-9-methoxy-4-(3-methylbut-2-enyl)-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 42417638) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-9-methoxy-4-(3-methylbut-2-enyl)-3,5-dihydro-2H-1,4-benzoxazepine.
| Compound Name | 7-(3,4-dimethoxyphenyl)-9-methoxy-4-(3-methylbut-2-enyl)-3,5-dihydro-2H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 42417638 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-9-methoxy-4-(3-methylbut-2-enyl)-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | COc1ccc(-c2cc3c(c(OC)c2)OCCN(CC=C(C)C)C3)cc1OC |
| InChI | InChI=1S/C23H29NO4/c1-16(2)8-9-24-10-11-28-23-19(15-24)12-18(14-22(23)27-5)17-6-7-20(25-3)21(13-17)26-4/h6-8,12-14H,9-11,15H2,1-5H3 |
| InChIKey | QZAQKXXKHNKPIO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|