C21H21N2O6P — CID 4241935
2-[[bis(3-methoxyphenoxy)phosphorylhydrazinylidene]methyl]phenol (PubChem CID 4241935) has the molecular formula C21H21N2O6P and a molecular weight of 428.38 g/mol. Its IUPAC name is 2-[[bis(3-methoxyphenoxy)phosphorylhydrazinylidene]methyl]phenol.
| Compound Name | 2-[[bis(3-methoxyphenoxy)phosphorylhydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 4241935 |
| Molecular Formula | C21H21N2O6P |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-[[bis(3-methoxyphenoxy)phosphorylhydrazinylidene]methyl]phenol |
| SMILES | COc1cccc(OP(=O)(NN=Cc2ccccc2O)Oc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C21H21N2O6P/c1-26-17-8-5-10-19(13-17)28-30(25,29-20-11-6-9-18(14-20)27-2)23-22-15-16-7-3-4-12-21(16)24/h3-15,24H,1-2H3,(H,23,25) |
| InChIKey | GUZYLAVFIWLXJR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|