C23H24BrN2O4P — CID 135890288
2-[(Z)-[bis(2,3-dimethylphenoxy)phosphorylhydrazinylidene]methyl]-4-bromophenol (PubChem CID 135890288) has the molecular formula C23H24BrN2O4P and a molecular weight of 503.33 g/mol. Its IUPAC name is 2-[(Z)-[bis(2,3-dimethylphenoxy)phosphorylhydrazinylidene]methyl]-4-bromophenol.
| Compound Name | 2-[(Z)-[bis(2,3-dimethylphenoxy)phosphorylhydrazinylidene]methyl]-4-bromophenol |
|---|---|
| PubChem CID | 135890288 |
| Molecular Formula | C23H24BrN2O4P |
| Molecular Weight | 503.33 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 2-[(Z)-[bis(2,3-dimethylphenoxy)phosphorylhydrazinylidene]methyl]-4-bromophenol |
| SMILES | Cc1cccc(OP(=O)(N/N=C\c2cc(Br)ccc2O)Oc2cccc(C)c2C)c1C |
| InChI | InChI=1S/C23H24BrN2O4P/c1-15-7-5-9-22(17(15)3)29-31(28,30-23-10-6-8-16(2)18(23)4)26-25-14-19-13-20(24)11-12-21(19)27/h5-14,27H,1-4H3,(H,26,28)/b25-14- |
| InChIKey | WEGOCNUQJFBTMP-QFEZKATASA-N |
| XLogP | 6.58 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.33 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|