C26H25N5O2 — CID 42421285
1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-N-[(2-methoxyphenyl)methyl]-5-methylpyrazole-4-carboxamide (PubChem CID 42421285) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-N-[(2-methoxyphenyl)methyl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-N-[(2-methoxyphenyl)methyl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 42421285 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-N-[(2-methoxyphenyl)methyl]-5-methylpyrazole-4-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1cnn(-c2ncc3c(n2)-c2ccccc2CCC3)c1C |
| InChI | InChI=1S/C26H25N5O2/c1-17-22(25(32)27-14-19-9-4-6-13-23(19)33-2)16-29-31(17)26-28-15-20-11-7-10-18-8-3-5-12-21(18)24(20)30-26/h3-6,8-9,12-13,15-16H,7,10-11,14H2,1-2H3,(H,27,32) |
| InChIKey | GKFHUCMXNKPWQA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |