C21H25N5O4 — CID 42421765
N,N-diethyl-3-(tetrazol-1-yl)-5-(2,3,4-trimethoxyphenyl)benzamide (PubChem CID 42421765) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is N,N-diethyl-3-(tetrazol-1-yl)-5-(2,3,4-trimethoxyphenyl)benzamide.
| Compound Name | N,N-diethyl-3-(tetrazol-1-yl)-5-(2,3,4-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 42421765 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N,N-diethyl-3-(tetrazol-1-yl)-5-(2,3,4-trimethoxyphenyl)benzamide |
| SMILES | CCN(CC)C(=O)c1cc(-c2ccc(OC)c(OC)c2OC)cc(-n2cnnn2)c1 |
| InChI | InChI=1S/C21H25N5O4/c1-6-25(7-2)21(27)15-10-14(11-16(12-15)26-13-22-23-24-26)17-8-9-18(28-3)20(30-5)19(17)29-4/h8-13H,6-7H2,1-5H3 |
| InChIKey | ZUIYHSKAUYDGQU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |