C26H27N5O3 — CID 25252796
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethylphenyl)-5-(tetrazol-1-yl)benzamide (PubChem CID 25252796) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethylphenyl)-5-(tetrazol-1-yl)benzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethylphenyl)-5-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 25252796 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethylphenyl)-5-(tetrazol-1-yl)benzamide |
| SMILES | CCc1ccccc1-c1cc(C(=O)NCCc2ccc(OC)c(OC)c2)cc(-n2cnnn2)c1 |
| InChI | InChI=1S/C26H27N5O3/c1-4-19-7-5-6-8-23(19)20-14-21(16-22(15-20)31-17-28-29-30-31)26(32)27-12-11-18-9-10-24(33-2)25(13-18)34-3/h5-10,13-17H,4,11-12H2,1-3H3,(H,27,32) |
| InChIKey | MXRXIOCXSDJGPD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |