C22H19FN6O3S — CID 25253261
N-[2-(2-fluorophenyl)ethyl]-3-(5-methylsulfonyl-2-pyridinyl)-5-(tetrazol-1-yl)benzamide (PubChem CID 25253261) has the molecular formula C22H19FN6O3S and a molecular weight of 466.50 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-3-(5-methylsulfonyl-2-pyridinyl)-5-(tetrazol-1-yl)benzamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-3-(5-methylsulfonyl-2-pyridinyl)-5-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 25253261 |
| Molecular Formula | C22H19FN6O3S |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-3-(5-methylsulfonyl-2-pyridinyl)-5-(tetrazol-1-yl)benzamide |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(C(=O)NCCc3ccccc3F)cc(-n3cnnn3)c2)nc1 |
| InChI | InChI=1S/C22H19FN6O3S/c1-33(31,32)19-6-7-21(25-13-19)16-10-17(12-18(11-16)29-14-26-27-28-29)22(30)24-9-8-15-4-2-3-5-20(15)23/h2-7,10-14H,8-9H2,1H3,(H,24,30) |
| InChIKey | FJCIBCLERRBYNK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |