C16H18ClNO2 — CID 42427353
ethyl (3aR,4R,9bR)-7-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate (PubChem CID 42427353) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is ethyl (3aR,4R,9bR)-7-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate.
| Compound Name | ethyl (3aR,4R,9bR)-7-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 42427353 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethyl (3aR,4R,9bR)-7-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Nc2c(ccc(Cl)c2C)[C@@H]2C=CC[C@@H]12 |
| InChI | InChI=1S/C16H18ClNO2/c1-3-20-16(19)15-11-6-4-5-10(11)12-7-8-13(17)9(2)14(12)18-15/h4-5,7-8,10-11,15,18H,3,6H2,1-2H3/t10-,11-,15-/m1/s1 |
| InChIKey | JNBOCINZSVUYDA-UEKVPHQBSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|