C10H13N3O5 — CID 42427714
3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]propanoic acid (PubChem CID 42427714) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]propanoic acid.
| Compound Name | 3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 42427714 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]propanoic acid |
| SMILES | CN1C(=O)C(/C=N/CCC(=O)O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C10H13N3O5/c1-12-8(16)6(5-11-4-3-7(14)15)9(17)13(2)10(12)18/h5-6H,3-4H2,1-2H3,(H,14,15)/b11-5+ |
| InChIKey | DQHJZRQFFQXXKM-VZUCSPMQSA-N |
| XLogP | -0.80 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|