C7H9N2O4+ — CID 73165154
1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylic acid (PubChem CID 73165154) has the molecular formula C7H9N2O4+ and a molecular weight of 185.16 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylic acid.
| Compound Name | 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 73165154 |
| Molecular Formula | C7H9N2O4+ |
| Molecular Weight | 185.16 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylic acid |
| SMILES | CN1C(=O)C(C(=O)O)C=[N+](C)C1=O |
| InChI | InChI=1S/C7H8N2O4/c1-8-3-4(6(11)12)5(10)9(2)7(8)13/h3-4H,1-2H3/p+1 |
| InChIKey | WCCBUKRESOWSLK-UHFFFAOYSA-O |
| XLogP | -1.01 |
| TPSA | 77.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.16 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|