About methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate
methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate (PubChem CID 73183797) has the molecular formula C8H11N2O4+
and a molecular weight of 199.19 g/mol. Its IUPAC name is methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate.
Molecular Properties
| Compound Name | methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate |
| PubChem CID | 73183797 |
| Molecular Formula | C8H11N2O4+ |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate |
| SMILES | COC(=O)C1C=[N+](C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C8H11N2O4/c1-9-4-5(7(12)14-3)6(11)10(2)8(9)13/h4-5H,1-3H3/q+1 |
| InChIKey | MQYYKNULLSFVLE-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate?
The IUPAC name of methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate (CID 73183797) is methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate.
What is the SMILES notation for methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate?
The canonical SMILES for methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate is COC(=O)C1C=[N+](C)C(=O)N(C)C1=O.
What is the InChIKey of methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate?
The InChIKey is MQYYKNULLSFVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N2O4/c1-9-4-5(7(12)14-3)6(11)10(2)8(9)13/h4-5H,1-3H3/q+1.
What are the key properties of methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate?
methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate has a molecular weight of 199.19 g/mol, XLogP of -0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylate is sourced from PubChem (CID 73183797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).