About 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid
3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid (PubChem CID 123557230) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid.
Analyze 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid?
The IUPAC name of 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid (CID 123557230) is 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid.
What is the SMILES notation for 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid?
The canonical SMILES for 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid is CN1CC(C(=O)O)C=NC1=O.
What is the InChIKey of 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid?
The InChIKey is RYDGSQAPETVXPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-8-3-4(5(9)10)2-7-6(8)11/h2,4H,3H2,1H3,(H,9,10).
What are the key properties of 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid?
3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid has a molecular weight of 156.14 g/mol, XLogP of -0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-oxo-4,5-dihydropyrimidine-5-carboxylic acid is sourced from PubChem (CID 123557230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).