C22H19FN2S2 — CID 42428742
1-(4-fluorophenyl)-N-[(7-methylsulfanyl-2-thiophen-2-ylquinolin-3-yl)methyl]methanamine (PubChem CID 42428742) has the molecular formula C22H19FN2S2 and a molecular weight of 394.54 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(7-methylsulfanyl-2-thiophen-2-ylquinolin-3-yl)methyl]methanamine.
| Compound Name | 1-(4-fluorophenyl)-N-[(7-methylsulfanyl-2-thiophen-2-ylquinolin-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 42428742 |
| Molecular Formula | C22H19FN2S2 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(7-methylsulfanyl-2-thiophen-2-ylquinolin-3-yl)methyl]methanamine |
| SMILES | CSc1ccc2cc(CNCc3ccc(F)cc3)c(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C22H19FN2S2/c1-26-19-9-6-16-11-17(14-24-13-15-4-7-18(23)8-5-15)22(25-20(16)12-19)21-3-2-10-27-21/h2-12,24H,13-14H2,1H3 |
| InChIKey | VWYPKKWUEFMLJH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |