C19H22N2OS2 — CID 56856636
1-methoxy-N-[(7-methylsulfanyl-2-thiophen-2-ylquinolin-3-yl)methyl]propan-2-amine (PubChem CID 56856636) has the molecular formula C19H22N2OS2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-methoxy-N-[(7-methylsulfanyl-2-thiophen-2-ylquinolin-3-yl)methyl]propan-2-amine.
| Compound Name | 1-methoxy-N-[(7-methylsulfanyl-2-thiophen-2-ylquinolin-3-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 56856636 |
| Molecular Formula | C19H22N2OS2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1-methoxy-N-[(7-methylsulfanyl-2-thiophen-2-ylquinolin-3-yl)methyl]propan-2-amine |
| SMILES | COCC(C)NCc1cc2ccc(SC)cc2nc1-c1cccs1 |
| InChI | InChI=1S/C19H22N2OS2/c1-13(12-22-2)20-11-15-9-14-6-7-16(23-3)10-17(14)21-19(15)18-5-4-8-24-18/h4-10,13,20H,11-12H2,1-3H3 |
| InChIKey | CTXUWZABVPRGQI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |