C25H29N3O5 — CID 42429191
2-[(3R)-2,5-dioxo-3-phenyl-1-(3-pyridin-3-yloxypropyl)pyrrolidin-3-yl]-N-methyl-N-[(3S)-oxolan-3-yl]acetamide (PubChem CID 42429191) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 2-[(3R)-2,5-dioxo-3-phenyl-1-(3-pyridin-3-yloxypropyl)pyrrolidin-3-yl]-N-methyl-N-[(3S)-oxolan-3-yl]acetamide.
| Compound Name | 2-[(3R)-2,5-dioxo-3-phenyl-1-(3-pyridin-3-yloxypropyl)pyrrolidin-3-yl]-N-methyl-N-[(3S)-oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 42429191 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-[(3R)-2,5-dioxo-3-phenyl-1-(3-pyridin-3-yloxypropyl)pyrrolidin-3-yl]-N-methyl-N-[(3S)-oxolan-3-yl]acetamide |
| SMILES | CN(C(=O)C[C@]1(c2ccccc2)CC(=O)N(CCCOc2cccnc2)C1=O)[C@H]1CCOC1 |
| InChI | InChI=1S/C25H29N3O5/c1-27(20-10-14-32-18-20)22(29)15-25(19-7-3-2-4-8-19)16-23(30)28(24(25)31)12-6-13-33-21-9-5-11-26-17-21/h2-5,7-9,11,17,20H,6,10,12-16,18H2,1H3/t20-,25+/m0/s1 |
| InChIKey | WCASZNWDXOYJRX-NBGIEHNGSA-N |
| XLogP | 2.18 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|