C27H33N3O5 — CID 42485318
2-[(3R)-2,5-dioxo-3-phenyl-1-(3-pyridin-3-yloxypropyl)pyrrolidin-3-yl]-N-methyl-N-[[(2R)-oxan-2-yl]methyl]acetamide (PubChem CID 42485318) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[(3R)-2,5-dioxo-3-phenyl-1-(3-pyridin-3-yloxypropyl)pyrrolidin-3-yl]-N-methyl-N-[[(2R)-oxan-2-yl]methyl]acetamide.
| Compound Name | 2-[(3R)-2,5-dioxo-3-phenyl-1-(3-pyridin-3-yloxypropyl)pyrrolidin-3-yl]-N-methyl-N-[[(2R)-oxan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 42485318 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[(3R)-2,5-dioxo-3-phenyl-1-(3-pyridin-3-yloxypropyl)pyrrolidin-3-yl]-N-methyl-N-[[(2R)-oxan-2-yl]methyl]acetamide |
| SMILES | CN(C[C@H]1CCCCO1)C(=O)C[C@]1(c2ccccc2)CC(=O)N(CCCOc2cccnc2)C1=O |
| InChI | InChI=1S/C27H33N3O5/c1-29(20-23-11-5-6-15-35-23)24(31)17-27(21-9-3-2-4-10-21)18-25(32)30(26(27)33)14-8-16-34-22-12-7-13-28-19-22/h2-4,7,9-10,12-13,19,23H,5-6,8,11,14-18,20H2,1H3/t23-,27-/m1/s1 |
| InChIKey | WHQINWDOOSGZAE-YIXXDRMTSA-N |
| XLogP | 2.96 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|