C25H28FN3O3 — CID 42431117
1-[4-[2-(3,4-dimethoxyphenyl)-5-fluorobenzimidazol-1-yl]piperidin-1-yl]pent-4-en-1-one (PubChem CID 42431117) has the molecular formula C25H28FN3O3 and a molecular weight of 437.52 g/mol. Its IUPAC name is 1-[4-[2-(3,4-dimethoxyphenyl)-5-fluorobenzimidazol-1-yl]piperidin-1-yl]pent-4-en-1-one.
| Compound Name | 1-[4-[2-(3,4-dimethoxyphenyl)-5-fluorobenzimidazol-1-yl]piperidin-1-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 42431117 |
| Molecular Formula | C25H28FN3O3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-[4-[2-(3,4-dimethoxyphenyl)-5-fluorobenzimidazol-1-yl]piperidin-1-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCC(n2c(-c3ccc(OC)c(OC)c3)nc3cc(F)ccc32)CC1 |
| InChI | InChI=1S/C25H28FN3O3/c1-4-5-6-24(30)28-13-11-19(12-14-28)29-21-9-8-18(26)16-20(21)27-25(29)17-7-10-22(31-2)23(15-17)32-3/h4,7-10,15-16,19H,1,5-6,11-14H2,2-3H3 |
| InChIKey | WMVIAVAMYQSBDM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|