C24H30N2O4 — CID 42435212
N-[[4-methoxy-3-[[(3S)-oxolan-3-yl]methoxy]phenyl]methyl]-N-(pyridin-3-ylmethyl)pent-4-enamide (PubChem CID 42435212) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is N-[[4-methoxy-3-[[(3S)-oxolan-3-yl]methoxy]phenyl]methyl]-N-(pyridin-3-ylmethyl)pent-4-enamide.
| Compound Name | N-[[4-methoxy-3-[[(3S)-oxolan-3-yl]methoxy]phenyl]methyl]-N-(pyridin-3-ylmethyl)pent-4-enamide |
|---|---|
| PubChem CID | 42435212 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-[[4-methoxy-3-[[(3S)-oxolan-3-yl]methoxy]phenyl]methyl]-N-(pyridin-3-ylmethyl)pent-4-enamide |
| SMILES | C=CCCC(=O)N(Cc1cccnc1)Cc1ccc(OC)c(OC[C@H]2CCOC2)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-3-4-7-24(27)26(16-20-6-5-11-25-14-20)15-19-8-9-22(28-2)23(13-19)30-18-21-10-12-29-17-21/h3,5-6,8-9,11,13-14,21H,1,4,7,10,12,15-18H2,2H3/t21-/m0/s1 |
| InChIKey | HGBIANQRUPUNDD-NRFANRHFSA-N |
| XLogP | 4.00 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|