C23H33NO5 — CID 42499790
N-[[4-methoxy-3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]pent-4-enamide (PubChem CID 42499790) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-[[4-methoxy-3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]pent-4-enamide.
| Compound Name | N-[[4-methoxy-3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]pent-4-enamide |
|---|---|
| PubChem CID | 42499790 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | N-[[4-methoxy-3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]pent-4-enamide |
| SMILES | C=CCCC(=O)N(Cc1ccc(OC)c(OCC2(C)COC2)c1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C23H33NO5/c1-4-5-8-22(25)24(14-19-7-6-11-28-19)13-18-9-10-20(26-3)21(12-18)29-17-23(2)15-27-16-23/h4,9-10,12,19H,1,5-8,11,13-17H2,2-3H3/t19-/m1/s1 |
| InChIKey | WZTXBRYEQNTRPN-LJQANCHMSA-N |
| XLogP | 3.58 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|