C21H24N2O2S — CID 42438989
(5R)-3-benzhydryl-N-(3-methylsulfanylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 42438989) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is (5R)-3-benzhydryl-N-(3-methylsulfanylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (5R)-3-benzhydryl-N-(3-methylsulfanylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 42438989 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (5R)-3-benzhydryl-N-(3-methylsulfanylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CSCCCNC(=O)[C@H]1CC(C(c2ccccc2)c2ccccc2)=NO1 |
| InChI | InChI=1S/C21H24N2O2S/c1-26-14-8-13-22-21(24)19-15-18(23-25-19)20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,19-20H,8,13-15H2,1H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | AAENCAIBSMUUST-LJQANCHMSA-N |
| XLogP | 3.83 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|