C23H28N4O3 — CID 42439723
(3S)-N-[1-[4-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]pyrazol-4-yl]oxolane-3-carboxamide (PubChem CID 42439723) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is (3S)-N-[1-[4-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]pyrazol-4-yl]oxolane-3-carboxamide.
| Compound Name | (3S)-N-[1-[4-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]pyrazol-4-yl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 42439723 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (3S)-N-[1-[4-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]pyrazol-4-yl]oxolane-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc(-n2cc(NC(=O)[C@H]3CCOC3)cn2)cc1 |
| InChI | InChI=1S/C23H28N4O3/c28-22(24-12-10-17-4-2-1-3-5-17)18-6-8-21(9-7-18)27-15-20(14-25-27)26-23(29)19-11-13-30-16-19/h4,6-9,14-15,19H,1-3,5,10-13,16H2,(H,24,28)(H,26,29)/t19-/m0/s1 |
| InChIKey | UOSFOEYDEASXBG-IBGZPJMESA-N |
| XLogP | 3.47 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|