C24H26N2O3 — CID 42440870
N-(4-butylphenyl)-1-methyl-4-oxo-5-phenylmethoxypyridine-2-carboxamide (PubChem CID 42440870) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-(4-butylphenyl)-1-methyl-4-oxo-5-phenylmethoxypyridine-2-carboxamide.
| Compound Name | N-(4-butylphenyl)-1-methyl-4-oxo-5-phenylmethoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 42440870 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-(4-butylphenyl)-1-methyl-4-oxo-5-phenylmethoxypyridine-2-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)c2cc(=O)c(OCc3ccccc3)cn2C)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-3-4-8-18-11-13-20(14-12-18)25-24(28)21-15-22(27)23(16-26(21)2)29-17-19-9-6-5-7-10-19/h5-7,9-16H,3-4,8,17H2,1-2H3,(H,25,28) |
| InChIKey | JUYGXSRREGXYBI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |