C19H26N4O3S2 — CID 42441881
(5S)-5-ethyl-3-(2-methylprop-2-enyl)-5-[1-(2-methylsulfanyl-1,3-thiazole-4-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42441881) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is (5S)-5-ethyl-3-(2-methylprop-2-enyl)-5-[1-(2-methylsulfanyl-1,3-thiazole-4-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-ethyl-3-(2-methylprop-2-enyl)-5-[1-(2-methylsulfanyl-1,3-thiazole-4-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42441881 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (5S)-5-ethyl-3-(2-methylprop-2-enyl)-5-[1-(2-methylsulfanyl-1,3-thiazole-4-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | C=C(C)CN1C(=O)N[C@@](CC)(C2CCN(C(=O)c3csc(SC)n3)CC2)C1=O |
| InChI | InChI=1S/C19H26N4O3S2/c1-5-19(16(25)23(10-12(2)3)17(26)21-19)13-6-8-22(9-7-13)15(24)14-11-28-18(20-14)27-4/h11,13H,2,5-10H2,1,3-4H3,(H,21,26)/t19-/m0/s1 |
| InChIKey | DAPPNEJSKQZYKT-IBGZPJMESA-N |
| XLogP | 2.99 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|