C23H27ClN4O3S — CID 45165780
5-[1-(2-chlorobenzoyl)piperidin-4-yl]-5-ethyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 45165780) has the molecular formula C23H27ClN4O3S and a molecular weight of 475.01 g/mol. Its IUPAC name is 5-[1-(2-chlorobenzoyl)piperidin-4-yl]-5-ethyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[1-(2-chlorobenzoyl)piperidin-4-yl]-5-ethyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45165780 |
| Molecular Formula | C23H27ClN4O3S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 5-[1-(2-chlorobenzoyl)piperidin-4-yl]-5-ethyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CCC1(C2CCN(C(=O)c3ccccc3Cl)CC2)NC(=O)N(CCc2scnc2C)C1=O |
| InChI | InChI=1S/C23H27ClN4O3S/c1-3-23(21(30)28(22(31)26-23)13-10-19-15(2)25-14-32-19)16-8-11-27(12-9-16)20(29)17-6-4-5-7-18(17)24/h4-7,14,16H,3,8-13H2,1-2H3,(H,26,31) |
| InChIKey | MRGIRSFYOKJLAG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|