C27H37N5O2S — CID 45179778
5-[1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-4-yl]-5-ethyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 45179778) has the molecular formula C27H37N5O2S and a molecular weight of 495.69 g/mol. Its IUPAC name is 5-[1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-4-yl]-5-ethyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-4-yl]-5-ethyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45179778 |
| Molecular Formula | C27H37N5O2S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 5-[1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-4-yl]-5-ethyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CCC1(C2CCN(C/C=C/c3ccc(N(C)C)cc3)CC2)NC(=O)N(CCc2scnc2C)C1=O |
| InChI | InChI=1S/C27H37N5O2S/c1-5-27(25(33)32(26(34)29-27)18-14-24-20(2)28-19-35-24)22-12-16-31(17-13-22)15-6-7-21-8-10-23(11-9-21)30(3)4/h6-11,19,22H,5,12-18H2,1-4H3,(H,29,34)/b7-6+ |
| InChIKey | JHBVKJQCHBPGMK-VOTSOKGWSA-N |
| XLogP | 4.19 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|