C22H28FN3O3S — CID 4244458
N-(3-fluoro-4-methylphenyl)-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 4244458) has the molecular formula C22H28FN3O3S and a molecular weight of 433.55 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 4244458 |
| Molecular Formula | C22H28FN3O3S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCN(S(=O)(=O)c3ccc(C(C)C)cc3)CC2)cc1F |
| InChI | InChI=1S/C22H28FN3O3S/c1-16(2)18-5-8-20(9-6-18)30(28,29)26-12-10-25(11-13-26)15-22(27)24-19-7-4-17(3)21(23)14-19/h4-9,14,16H,10-13,15H2,1-3H3,(H,24,27) |
| InChIKey | HEJJEPGYHWQZND-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |