C40H40F4N2O4 — CID 4244949
N-(2-adamantyl)-4-[4-[4-(2-adamantylcarbamoyl)phenoxy]-2,3,5,6-tetrafluorophenoxy]benzamide (PubChem CID 4244949) has the molecular formula C40H40F4N2O4 and a molecular weight of 688.76 g/mol. Its IUPAC name is N-(2-adamantyl)-4-[4-[4-(2-adamantylcarbamoyl)phenoxy]-2,3,5,6-tetrafluorophenoxy]benzamide.
| Compound Name | N-(2-adamantyl)-4-[4-[4-(2-adamantylcarbamoyl)phenoxy]-2,3,5,6-tetrafluorophenoxy]benzamide |
|---|---|
| PubChem CID | 4244949 |
| Molecular Formula | C40H40F4N2O4 |
| Molecular Weight | 688.76 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | N-(2-adamantyl)-4-[4-[4-(2-adamantylcarbamoyl)phenoxy]-2,3,5,6-tetrafluorophenoxy]benzamide |
| SMILES | O=C(NC1C2CC3CC(C2)CC1C3)c1ccc(Oc2c(F)c(F)c(Oc3ccc(C(=O)NC4C5CC6CC(C5)CC4C6)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C40H40F4N2O4/c41-31-33(43)38(50-30-7-3-24(4-8-30)40(48)46-36-27-15-21-10-22(17-27)18-28(36)16-21)34(44)32(42)37(31)49-29-5-1-23(2-6-29)39(47)45-35-25-11-19-9-20(13-25)14-26(35)12-19/h1-8,19-22,25-28,35-36H,9-18H2,(H,45,47)(H,46,48) |
| InChIKey | HXLRDZNTBBMRIW-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.76 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|