C19H16Cl2N2O — CID 4245113
N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]cyclopropanecarboxamide (PubChem CID 4245113) has the molecular formula C19H16Cl2N2O and a molecular weight of 359.26 g/mol. Its IUPAC name is N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 4245113 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]cyclopropanecarboxamide |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)C1CC1 |
| InChI | InChI=1S/C19H16Cl2N2O/c1-11-8-15(16(10-22)12-4-6-14(20)7-5-12)17(21)9-18(11)23-19(24)13-2-3-13/h4-9,13,16H,2-3H2,1H3,(H,23,24) |
| InChIKey | CRKZDVKLSHHJBB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |